Online Database of Chemicals from Around the World
| Name | Trimethylsilyl p-Toluenesulphonate |
|---|---|
| Synonyms | 4-Methylbenzenesulfonic Acid Trimethylsilyl Ester; Trimethylsilyl P-Toluenesulphonate |
| Molecular Structure |  |
| Molecular Formula | C10H16O3SSi |
| Molecular Weight | 244.38 |
| CAS Registry Number | 17872-98-9 |
| EINECS | 241-826-3 |
| SMILES | C1=C([S](O[Si](C)(C)C)(=O)=O)C=CC(=C1)C |
| InChI | 1S/C10H16O3SSi/c1-9-5-7-10(8-6-9)14(11,12)13-15(2,3)4/h5-8H,1-4H3 |
| InChIKey | GDEWVMDXPUXBKU-UHFFFAOYSA-N |
| Density | 1.098g/cm3 (Cal.) |
|---|---|
| Boiling point | 273.99°C at 760 mmHg (Cal.) |
| Flash point | 119.505°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Trimethylsilyl p-Toluenesulphonate |
