Online Database of Chemicals from Around the World
|
CAS#: 178813-61-1 Product: 2,2',2'',2'''-(1,1,2,2-Ethanetetrayl)Tetrakis(1,3-Benzothiazole) No suppilers available for the product. |
| Name | 2,2',2'',2'''-(1,1,2,2-Ethanetetrayl)Tetrakis(1,3-Benzothiazole) |
|---|---|
| Synonyms | 2,2',2'',2'''-(1,2-Ethanediylidene)tetrakisbenzothiazole |
| Molecular Structure |  |
| Molecular Formula | C30H18N4S4 |
| Molecular Weight | 562.75 |
| CAS Registry Number | 178813-61-1 |
| SMILES | c1ccc2c(c1)nc(s2)C(c3nc4ccccc4s3)C(c5nc6ccccc6s5)c7nc8ccccc8s7 |
| InChI | 1S/C30H18N4S4/c1-5-13-21-17(9-1)31-27(35-21)25(28-32-18-10-2-6-14-22(18)36-28)26(29-33-19-11-3-7-15-23(19)37-29)30-34-20-12-4-8-16-24(20)38-30/h1-16,25-26H |
| InChIKey | SEUXXZOQRPCVKJ-UHFFFAOYSA-N |
| Density | 1.489g/cm3 (Cal.) |
|---|---|
| Boiling point | 741.927°C at 760 mmHg (Cal.) |
| Flash point | 360.053°C (Cal.) |
| Refractive index | 1.833 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2',2'',2'''-(1,1,2,2-Ethanetetrayl)Tetrakis(1,3-Benzothiazole) |