Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Gelest, Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (215) 547-1015 | |||
|
info@gelest.com | |||
| Chemical manufacturer | ||||
| Name | Bis(Trimethylsilylmethyl)Amine |
|---|---|
| Synonyms | Bis(Trimethylsilylmethyl)Amine; Methanamine, 1-(Trimethylsilyl)-N-((Trimethylsilyl)Methyl)-; Methanamine, 1-(Trimethylsilyl)-N-[(Trimethylsilyl)Methyl]- |
| Molecular Structure |  |
| Molecular Formula | C8H23NSi2 |
| Molecular Weight | 189.45 |
| CAS Registry Number | 17882-91-6 |
| SMILES | C([Si](C)(C)C)NC[Si](C)(C)C |
| InChI | 1S/C8H23NSi2/c1-10(2,3)7-9-8-11(4,5)6/h9H,7-8H2,1-6H3 |
| InChIKey | BZJILDWKZIVTPE-UHFFFAOYSA-N |
| Density | 0.786g/cm3 (Cal.) |
|---|---|
| Boiling point | 174.971°C at 760 mmHg (Cal.) |
| Flash point | 59.62°C (Cal.) |
| Refractive index | 1.4267 (Expl.) |
| Market Analysis Reports |
| List of Reports Available for Bis(Trimethylsilylmethyl)Amine |