| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 13417589054/ | |||
![]() |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer | ||||
| Classification | Biochemical >> Amino acids and their derivatives >> Proline derivatives |
|---|---|
| Name | Methyl (4S)-4-Hydroxy-D-Prolinate |
| Synonyms | (2R,4S)-methyl 4-hydroxypyrrolidine-2-carboxylate; D-Proline,4-hydroxy-,methyl ester,(4S) |
| Molecular Structure | ![]() |
| Molecular Formula | C6H11NO3 |
| Molecular Weight | 145.16 |
| CAS Registry Number | 178962-09-9 |
| SMILES | O=C(OC)[C@@H]1NC[C@@H](O)C1 |
| InChI | 1S/C6H11NO3/c1-10-6(9)5-2-4(8)3-7-5/h4-5,7-8H,2-3H2,1H3/t4-,5+/m0/s1 |
| InChIKey | ZORHSASAYVIBLY-CRCLSJGQSA-N |
| Density | 1.216g/cm3 (Cal.) |
|---|---|
| Boiling point | 247.177°C at 760 mmHg (Cal.) |
| Flash point | 103.289°C (Cal.) |
| Refractive index | 1.487 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Methyl (4S)-4-Hydroxy-D-Prolinate |