Online Database of Chemicals from Around the World
| Name | 1,8-Diethenylnaphthalene |
|---|---|
| Synonyms | 1,8-Divinylnaphthalene; Naphthalene, 1,8-Diethenyl-; 1,8-Diethenylnaphthalene |
| Molecular Structure |  |
| Molecular Formula | C14H12 |
| Molecular Weight | 180.25 |
| CAS Registry Number | 17935-66-9 |
| SMILES | C1=C2C(=C(C=C1)C=C)C(=CC=C2)C=C |
| InChI | 1S/C14H12/c1-3-11-7-5-9-13-10-6-8-12(4-2)14(11)13/h3-10H,1-2H2 |
| InChIKey | FTUDIUREWUBVKL-UHFFFAOYSA-N |
| Density | 1.027g/cm3 (Cal.) |
|---|---|
| Boiling point | 315.934°C at 760 mmHg (Cal.) |
| Flash point | 150.38°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,8-Diethenylnaphthalene |
