Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Acetoxytri-Tert-Butoxysilane |
|---|---|
| Synonyms | Tritert-Butoxysilyl Acetate; Acetic Acid Tritert-Butoxysilyl Ester; Tris[(2-Methylpropan-2-Yl)Oxy]Silyl Ethanoate |
| Molecular Structure |  |
| Molecular Formula | C14H30O5Si |
| Molecular Weight | 306.47 |
| CAS Registry Number | 17947-85-2 |
| EINECS | 241-875-0 |
| SMILES | CC(O[Si](OC(C)=O)(OC(C)(C)C)OC(C)(C)C)(C)C |
| InChI | 1S/C14H30O5Si/c1-11(15)16-20(17-12(2,3)4,18-13(5,6)7)19-14(8,9)10/h1-10H3 |
| InChIKey | STCHVBTVDSDGFF-UHFFFAOYSA-N |
| Density | 0.963g/cm3 (Cal.) |
|---|---|
| Boiling point | 285.204°C at 760 mmHg (Cal.) |
| Flash point | 105.004°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Acetoxytri-Tert-Butoxysilane |