|
CAS#: 17951-19-8 Product: Justicidin B No suppilers available for the product. |
| Name | Justicidin B |
|---|---|
| Synonyms | 9-(1,3-Benzodioxol-5-Yl)-6,7-Dimethoxy-3H-Benzo[F]Isobenzofuran-1-One; Aids-210377; St077116 |
| Molecular Structure | ![]() |
| Molecular Formula | C21H16O6 |
| Molecular Weight | 364.35 |
| CAS Registry Number | 17951-19-8 |
| SMILES | C2=C1C(=C3C(=CC1=CC(=C2OC)OC)COC3=O)C4=CC5=C(C=C4)OCO5 |
| InChI | 1S/C21H16O6/c1-23-16-7-12-5-13-9-25-21(22)20(13)19(14(12)8-17(16)24-2)11-3-4-15-18(6-11)27-10-26-15/h3-8H,9-10H2,1-2H3 |
| InChIKey | RTDRYYULUYRTAN-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 601.9±55.0°C at 760 mmHg (Cal.) |
| Flash point | 266.0±31.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Justicidin B |