| Zhengzhou Kingorgchem Chemical Technology Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.kingorgchem.com | |||
![]() | +86 (371) 6551-1006 | |||
![]() | +86 (371) 6575-6965 | |||
![]() | sales@kingorgchem.com | |||
![]() | QQ Chat | |||
![]() | WeChat: 18625597674 | |||
| Chemical manufacturer since 2015 | ||||
| chemBlink Standard supplier since 2016 | ||||
| Classification | Organic raw materials >> Organometallic compound >> Organic palladium |
|---|---|
| Name | [(1,2,3-ETA)-2-BUTEN-1-YL][DICYCLOHEXYL[3,6-DIMETHOXY-2',4',6'-TRIS(1-METHYLETHYL)[1,1'-BIPHENYL]-2-YL-KAPPAC1']PHOSPHINE-KAPPAP]-PALLADIUM(1+), 1,1,1-TRIFLUOROMETHANESULFONATE (1:1) |
| Molecular Structure | ![]() |
| Molecular Formula | C40H58F3O5PPdS |
| Molecular Weight | 845.34 |
| CAS Registry Number | 1798782-11-2 |
| SMILES | C/C=C[C@H]C.[Pd](P(C1CCCCC1)(C2CCCCC2)C3=C(C=C(C=C3C(C)C)OC)C4=C(C=C(C=C4C(C)C)OC)C5=CC=CC=C5)OS(=O)(=O)C(F)(F)F |
| Hazard Symbols | |
|---|---|
| Risk Statements | H315-H319 Details |
| Safety Statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 Details |
| SDS | Available |
|
[(1,2,3-ETA)-2-BUTEN-1-YL][DICYCLOHEXYL[3,6-DIMETHOXY-2',4',6'-TRIS(1-METHYLETHYL)[1,1'-BIPHENYL]-2-YL-KAPPAC1']PHOSPHINE-KAPPAP]-PALLADIUM(1+), 1,1,1-TRIFLUOROMETHANESULFONATE (1:1) is a specialized palladium complex known for its advanced catalytic properties. This compound integrates a sophisticated ligand system with a unique palladium coordination environment, making it valuable in a variety of chemical reactions. The structure of this compound features a palladium center coordinated with a complex ligand that includes a dicyclohexylphosphine moiety and a highly substituted biphenyl backbone. The ligand, characterized by 3,6-dimethoxy-2',4',6'-tris(1-methylethyl)[1,1'-biphenyl]-2-yl, provides a robust steric and electronic environment that enhances the palladium's catalytic activity. The ligand's design aims to optimize the palladium center's reactivity and stability in catalytic processes. The palladium center is further stabilized by the coordination of the (1,2,3-ETA)-2-buten-1-yl group and the presence of 1,1,1-trifluoromethanesulfonate (1:1) as a counterion. The trifluoromethanesulfonate (triflate) counterion helps to maintain the palladium in a soluble form and enhances the overall stability of the complex. The discovery of this complex was driven by the need for more efficient and selective catalytic systems in organic synthesis. The unique ligand environment provides improved performance in various palladium-catalyzed reactions, including cross-coupling reactions such as the Heck reaction. These reactions are essential for forming carbon-carbon bonds, which are crucial in the synthesis of complex organic molecules. The application of this palladium complex extends beyond traditional cross-coupling reactions. Its advanced ligand system allows for a broader range of catalytic transformations, including those involving oxidative and reductive processes. The enhanced stability and reactivity of the palladium center facilitate high-yield reactions and selective product formation. In summary, [(1,2,3-ETA)-2-BUTEN-1-YL][DICYCLOHEXYL[3,6-DIMETHOXY-2',4',6'-TRIS(1-METHYLETHYL)[1,1'-BIPHENYL]-2-YL-KAPPAC1']PHOSPHINE-KAPPAP]-PALLADIUM(1+), 1,1,1-TRIFLUOROMETHANESULFONATE (1:1) represents a significant advancement in catalytic chemistry. Its unique ligand design and palladium coordination environment make it a powerful tool for facilitating a wide range of chemical reactions with high efficiency and selectivity. |
| Market Analysis Reports |