Online Database of Chemicals from Around the World
|
CAS#: 180146-66-1 Product: [3-Nitro-5-(Trifluoromethyl)Phenyl]Methanol No suppilers available for the product. |
| Name | [3-Nitro-5-(Trifluoromethyl)Phenyl]Methanol |
|---|---|
| Synonyms | 3-Nitro-5-(trifluoromethyl)benzyl alcohol |
| Molecular Structure | ![CAS#: 180146-66-1， [3-Nitro-5-(Trifluoromethyl)Phenyl]Methanol](/moreStructures/180146-66-1.gif) |
| Molecular Formula | C8H6F3NO3 |
| Molecular Weight | 221.13 |
| CAS Registry Number | 180146-66-1 |
| SMILES | OCc1cc(cc(c1)C(F)(F)F)N(=O)=O |
| InChI | 1S/C8H6F3NO3/c9-8(10,11)6-1-5(4-13)2-7(3-6)12(14)15/h1-3,13H,4H2 |
| InChIKey | WSIIHVBSVSJXMQ-UHFFFAOYSA-N |
| Density | 1.488g/cm3 (Cal.) |
|---|---|
| Boiling point | 281.224°C at 760 mmHg (Cal.) |
| Flash point | 123.88°C (Cal.) |
| Refractive index | 1.507 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [3-Nitro-5-(Trifluoromethyl)Phenyl]Methanol |