Online Database of Chemicals from Around the World
| Name | Decafluoro-5-(Trifluoromethyl)Hexanoyl Fluoride |
|---|---|
| Synonyms | Decafluoro-5-(Trifluoromethyl)Hexanoyl Fluoride; Hexanoyl Fluoride, 2,2,3,3,4,4,5,6,6,6-Decafluoro-5-(Trifluoromethyl)- |
| Molecular Structure |  |
| Molecular Formula | C7F14O |
| Molecular Weight | 366.05 |
| CAS Registry Number | 18017-31-7 |
| EINECS | 241-926-7 |
| SMILES | O=C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | 1S/C7F14O/c8-1(22)2(9,10)4(12,13)5(14,15)3(11,6(16,17)18)7(19,20)21 |
| InChIKey | JQXGQDNUXYODIT-UHFFFAOYSA-N |
| Density | 1.681g/cm3 (Cal.) |
|---|---|
| Boiling point | 92.043°C at 760 mmHg (Cal.) |
| Flash point | 25.105°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Decafluoro-5-(Trifluoromethyl)Hexanoyl Fluoride |
