Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 1,3-Dichloro-2-Methylanthraquinone |
|---|---|
| Synonyms | 1,3-Dichloro-2-Methyl-Anthracene-9,10-Dione; 1,3-Dichloro-2-Methyl-9,10-Anthraquinone; 1,3-Dichloro-2-Methylanthraquinone |
| Molecular Structure |  |
| Molecular Formula | C15H8Cl2O2 |
| Molecular Weight | 291.13 |
| CAS Registry Number | 18018-09-2 |
| EINECS | 241-927-2 |
| SMILES | C1=C2C(=C(C(=C1Cl)C)Cl)C(C3=C(C2=O)C=CC=C3)=O |
| InChI | 1S/C15H8Cl2O2/c1-7-11(16)6-10-12(13(7)17)15(19)9-5-3-2-4-8(9)14(10)18/h2-6H,1H3 |
| InChIKey | QZKRKMRVWWGTRU-UHFFFAOYSA-N |
| Density | 1.461g/cm3 (Cal.) |
|---|---|
| Boiling point | 466.302°C at 760 mmHg (Cal.) |
| Flash point | 196.098°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3-Dichloro-2-Methylanthraquinone |