Online Database of Chemicals from Around the World
| Name | Hexacosafluoro-13-(Trifluoromethyl)Tetradecanoic Acid |
|---|---|
| Synonyms | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,14,14,14-Hexacosafluoro-13-(Trifluoromethyl)Myristic Acid; Tetradecanoic Acid, Hexacosafluoro-13-(Trifluoromethyl)- |
| Molecular Structure |  |
| Molecular Formula | C15HF29O2 |
| Molecular Weight | 764.13 |
| CAS Registry Number | 18024-09-4 |
| EINECS | 241-936-1 |
| SMILES | O=C(C(C(C(C(C(C(C(C(C(C(C(C(C(F)(F)F)(F)C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O |
| InChI | 1S/C15HF29O2/c16-2(17,1(45)46)4(19,20)6(23,24)8(27,28)10(31,32)12(35,36)13(37,38)11(33,34)9(29,30)7(25,26)5(21,22)3(18,14(39,40)41)15(42,43)44/h(H,45,46) |
| InChIKey | FQAXLPZGSQABMD-UHFFFAOYSA-N |
| Density | 1.779g/cm3 (Cal.) |
|---|---|
| Boiling point | 283.557°C at 760 mmHg (Cal.) |
| Flash point | 125.291°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Hexacosafluoro-13-(Trifluoromethyl)Tetradecanoic Acid |
