Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Trylead Chemical Technology Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
|
+86 (571) 8708-6220 | |||
|
info@trylead-chem.com | |||
| Chemical manufacturer since 2006 | ||||
| Name | 2,3,5,6-Tetrachloropyridine 1-Oxide |
|---|---|
| Synonyms | Pyridine, 2,3,5,6-tetrachloro-, 1-oxide; TL8001439 |
| Molecular Structure |  |
| Molecular Formula | C5HCl4NO |
| Molecular Weight | 232.88 |
| CAS Registry Number | 18032-57-0 |
| SMILES | Clc1c(Cl)[n+]([O-])c(Cl)c(Cl)c1 |
| InChI | 1S/C5HCl4NO/c6-2-1-3(7)5(9)10(11)4(2)8/h1H |
| InChIKey | VKMHSPSIFGYZGC-UHFFFAOYSA-N |
| Density | 1.795g/cm3 (Cal.) |
|---|---|
| Boiling point | 402.537°C at 760 mmHg (Cal.) |
| Flash point | 197.248°C (Cal.) |
| Refractive index | 1.631 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3,5,6-Tetrachloropyridine 1-Oxide |