Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | (1S,3E)-3-(Hydroxyimino)Cyclopentanecarboxylic Acid |
|---|---|
| Synonyms | (S,E)-3-(hydroxyimino)cyclopentanecarboxylic acid |
| Molecular Structure |  |
| Molecular Formula | C6H9NO3 |
| Molecular Weight | 143.14 |
| CAS Registry Number | 180323-54-0 |
| SMILES | C1C/C(=N\O)/C[C@H]1C(=O)O |
| InChI | 1S/C6H9NO3/c8-6(9)4-1-2-5(3-4)7-10/h4,10H,1-3H2,(H,8,9)/b7-5+/t4-/m0/s1 |
| InChIKey | AMAYWRJNZWREGD-LXZBKHJPSA-N |
| Density | 1.476g/cm3 (Cal.) |
|---|---|
| Boiling point | 360.894°C at 760 mmHg (Cal.) |
| Flash point | 172.063°C (Cal.) |
| Refractive index | 1.602 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1S,3E)-3-(Hydroxyimino)Cyclopentanecarboxylic Acid |