Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 1,8-Diethynyl-Naphthalene |
|---|---|
| Synonyms | Naphthalene, 1,8-Diethynyl-; 1,5-Diethynylnaphthalene |
| Molecular Structure |  |
| Molecular Formula | C14H8 |
| Molecular Weight | 176.22 |
| CAS Registry Number | 18067-44-2 |
| SMILES | C1=C(C2=C(C=C1)C=CC=C2C#C)C#C |
| InChI | 1S/C14H8/c1-3-11-7-5-9-13-10-6-8-12(4-2)14(11)13/h1-2,5-10H |
| InChIKey | IENBVLHUZUIOSC-UHFFFAOYSA-N |
| Density | 1.042g/cm3 (Cal.) |
|---|---|
| Boiling point | 305.763°C at 760 mmHg (Cal.) |
| Flash point | 142.505°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,8-Diethynyl-Naphthalene |