| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Dalton Pharma Services | Canada | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (416) 661-2102 | |||
![]() |
chemist@dalton.com | |||
| Chemical manufacturer | ||||
| LGC Standards | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (20) 8943-8480 | |||
![]() |
uksales@lgcstandards.com | |||
| Chemical manufacturer since 2007 | ||||
| Classification | Analytical chemistry >> Standard >> Pharmacopoeia standards and magazine standards |
|---|---|
| Name | Estra-1,3,5(10)-Triene-3,17beta-Diol 17-Butyrate |
| Synonyms | Butanoic Acid [(8R,9S,13S,14S,17S)-3-Hydroxy-13-Methyl-6,7,8,9,11,12,14,15,16,17-Decahydrocyclopenta[A]Phenanthren-17-Yl] Ester; Butyric Acid [(8R,9S,13S,14S,17S)-3-Hydroxy-13-Methyl-6,7,8,9,11,12,14,15,16,17-Decahydrocyclopenta[A]Phenanthren-17-Yl] Ester; Estra-1,3,5(10)-Triene-3,17Beta-Diol 17-Butyrate |
| Molecular Structure | ![]() |
| Molecular Formula | C22H30O3 |
| Molecular Weight | 342.48 |
| CAS Registry Number | 18069-79-9 |
| EINECS | 241-977-5 |
| SMILES | [C@@H]23C1=CC=C(C=C1CC[C@H]2[C@H]4[C@](CC3)([C@H](CC4)OC(CCC)=O)C)O |
| InChI | 1S/C22H30O3/c1-3-4-21(24)25-20-10-9-19-18-7-5-14-13-15(23)6-8-16(14)17(18)11-12-22(19,20)2/h6,8,13,17-20,23H,3-5,7,9-12H2,1-2H3/t17-,18-,19+,20+,22+/m1/s1 |
| InChIKey | XRKFWLKYSYKIKT-KOVVAJLHSA-N |
| Density | 1.15g/cm3 (Cal.) |
|---|---|
| Boiling point | 474.346°C at 760 mmHg (Cal.) |
| Flash point | 188.019°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Estra-1,3,5(10)-Triene-3,17beta-Diol 17-Butyrate |