Online Database of Chemicals from Around the World
| Name | Ethylidenebis[Trichlorosilane] |
|---|---|
| Synonyms | Ethylidenebis(Trichlorosilane) |
| Molecular Structure | ![CAS#: 18076-92-1， Ethylidenebis[Trichlorosilane]](/moreStructures/18076-92-1.gif) |
| Molecular Formula | C2H4Cl6Si2 |
| Molecular Weight | 296.94 |
| CAS Registry Number | 18076-92-1 |
| EINECS | 241-983-8 |
| SMILES | CC([Si](Cl)(Cl)Cl)[Si](Cl)(Cl)Cl |
| InChI | 1S/C2H4Cl6Si2/c1-2(9(3,4)5)10(6,7)8/h2H,1H3 |
| InChIKey | GQMOTYMECCJBDG-UHFFFAOYSA-N |
| Density | 1.472g/cm3 (Cal.) |
|---|---|
| Boiling point | 163.348°C at 760 mmHg (Cal.) |
| Flash point | 41.864°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethylidenebis[Trichlorosilane] |
