Online Database of Chemicals from Around the World
| Wuhan Sun-shine Bio-technology Corporation Limited | China | Inquire | ||
|---|---|---|---|---|
 | www.sun-shinechem.com | |||
 | +86 (27) 6552-2453 | |||
 | +86 (27) 6552-2452 | |||
 | marketing@sun-shinechem.com | |||
 | QQ Chat | |||
| Chemical manufacturer since 2011 | ||||
| chemBlink Standard supplier since 2010 | ||||
| Name | N-[4-[(2S)-2-[[(2S)-2-[(Methoxycarbonyl)amino]-1-oxo-3-phenylpropyl]amino]-2-[2-(2-thienyl)-4-thiazolyl]ethyl]phenyl]-sulfamic acid sodium salt (1:1) |
|---|---|
| Molecular Structure | ![CAS # 1809275-69-1, N-[4-[(2S)-2-[[(2S)-2-[(Methoxycarbonyl)amino]-1-oxo-3-phenylpropyl]amino]-2-[2-(2-thienyl)-4-thiazolyl]ethyl]phenyl]-sulfamic acid sodium salt (1:1)](/structures/1809275-69-1.gif) |
| Molecular Formula | C26H26N4O6S3 .Na |
| Molecular Weight | 609.69 |
| CAS Registry Number | 1809275-69-1 |
| SMILES | [C@@H](CC1=CC=C(NS(=O)(=O)O)C=C1)(NC([C@H](CC2=CC=CC=C2)NC(OC)=O)=O)C=3N=C(SC3)C4=CC=CS4.[Na] |