|
CAS#: 181136-65-2 Product: Phenyl 2,3,4-Tri-O-Acetyl-6-Deoxy-1-Thio-alpha-L-Mannopyranoside No suppilers available for the product. |
| Name | Phenyl 2,3,4-Tri-O-Acetyl-6-Deoxy-1-Thio-alpha-L-Mannopyranoside |
|---|---|
| Synonyms | Phenyl 2,3,4-tri-O-acetyl-a-L-thiorhamnopyranoside |
| Molecular Structure | ![]() |
| Molecular Formula | C18H22O7S |
| Molecular Weight | 382.43 |
| CAS Registry Number | 181136-65-2 |
| SMILES | O=C(O[C@H]2[C@@H](O[C@@H](Sc1ccccc1)[C@H](OC(=O)C)[C@@H]2OC(=O)C)C)C |
| InChI | 1S/C18H22O7S/c1-10-15(23-11(2)19)16(24-12(3)20)17(25-13(4)21)18(22-10)26-14-8-6-5-7-9-14/h5-10,15-18H,1-4H3/t10-,15-,16+,17+,18-/m0/s1 |
| InChIKey | YPJGKQRQWRZEKO-VVRBALCJSA-N |
| Density | 1.274g/cm3 (Cal.) |
|---|---|
| Boiling point | 457.284°C at 760 mmHg (Cal.) |
| Flash point | 215.976°C (Cal.) |
| Refractive index | 1.549 (Cal.) |
| (1) | Y.-F. Tsai, J.-T. Yang, J.-D. Chen and C.-H. Lin. Phenyl 2,3,4-tri-O-acetyl-1-thio-[alpha]-L-rhamnopyranoside: a glycosyl donor, Acta Cryst. (2007). E63, o3772 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Phenyl 2,3,4-Tri-O-Acetyl-6-Deoxy-1-Thio-alpha-L-Mannopyranoside |