Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Tetra(Methyl-D3)-Silane |
|---|---|
| Synonyms | Tetra(2H3)Methylsilane |
| Molecular Structure |  |
| Molecular Formula | C4D12Si |
| Molecular Weight | 100.30 |
| CAS Registry Number | 18145-38-5 |
| EINECS | 242-029-3 |
| SMILES | C([Si](C([2H])([2H])[2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])([2H])([2H])[2H] |
| InChI | 1S/C4H12Si/c1-5(2,3)4/h1-4H3/i1D3,2D3,3D3,4D3 |
| InChIKey | CZDYPVPMEAXLPK-MGKWXGLJSA-N |
| Density | 0.77g/cm3 (Cal.) |
|---|---|
| Boiling point | 26.799°C at 760 mmHg (Cal.) |
| Flash point | -45.645°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Tetra(Methyl-D3)-Silane |