| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Alfa Pyridines | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (609) 447-3255 | |||
![]() |
sales@pyridines.info | |||
| Chemical manufacturer | ||||
| Tocris Bioscience Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (636) 207-7651 | |||
![]() |
marketing@tocrisusa.com | |||
| Chemical manufacturer since 1982 | ||||
| Name | N-[3-Fluoro-5-(3-Pyridinyl)Phenyl]-5-Methoxy-6-(Trifluoromethyl)-1-Indolinecarboxamide |
|---|---|
| Synonyms | [181629-93-6]; 5-Methoxy |
| Molecular Structure | ![]() |
| Molecular Formula | C22H17F4N3O2 |
| Molecular Weight | 431.38 |
| CAS Registry Number | 181629-93-6 |
| SMILES | COC1=C(C=C2C(=C1)CCN2C(=O)NC3=CC(=CC(=C3)C4=CN=CC=C4)F)C(F)(F)F |
| InChI | 1S/C22H17F4N3O2/c1-31-20-9-13-4-6-29(19(13)11-18(20)22(24,25)26)21(30)28-17-8-15(7-16(23)10-17)14-3-2-5-27-12-14/h2-3,5,7-12H,4,6H2,1H3,(H,28,30) |
| InChIKey | RRJLJKRFFRZRAF-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 625.4±55.0°C at 760 mmHg (Cal.) |
| Flash point | 332.0±31.5°C (Cal.) |
| Refractive index | 1.6 (Cal.) |
| solubility | Soluble to 100 mM in DMSO |
| Market Analysis Reports |
| List of Reports Available for N-[3-Fluoro-5-(3-Pyridinyl)Phenyl]-5-Methoxy-6-(Trifluoromethyl)-1-Indolinecarboxamide |