Online Database of Chemicals from Around the World
| Carbosynth China Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 (512) 6260-5585 | |||
 |
sales@carbosynth.com | |||
 |
QQ Chat | |||
| Chemical manufacturer since 2006 Chemical distributor since 2006 | ||||
| chemBlink standard supplier since 2016 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 1-(2,4,5-Trimethoxyphenyl)-Ethanone |
|---|---|
| Synonyms | Nsc401454; 2',4',5'-Trimethoxyacetophenone; 1-(2,4,5-Trimethoxyphenyl)Ethan-1-One |
| Molecular Structure |  |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 |
| CAS Registry Number | 1818-28-6 |
| EINECS | 217-333-4 |
| SMILES | C1=C(C(=CC(=C1OC)OC)C(C)=O)OC |
| InChI | 1S/C11H14O4/c1-7(12)8-5-10(14-3)11(15-4)6-9(8)13-2/h5-6H,1-4H3 |
| InChIKey | GUTMBHHLVSFJIP-UHFFFAOYSA-N |
| Density | 1.089g/cm3 (Cal.) |
|---|---|
| Boiling point | 328.327°C at 760 mmHg (Cal.) |
| Flash point | 144.44°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1-(2,4,5-Trimethoxyphenyl)-Ethanone |