Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Spiro[3.5]Nona-1,6-Diene-2-Carboxamide |
|---|---|
| Synonyms | spiro[3.5]nona-1,6-diene-2-carboxamide |
| Molecular Structure | ![CAS#: 18205-68-0， Spiro[3.5]Nona-1,6-Diene-2-Carboxamide](/moreStructures/18205-68-0.gif) |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 |
| CAS Registry Number | 18205-68-0 |
| SMILES | C1CC2(CC=C1)CC(=C2)C(=O)N |
| InChI | 1S/C10H13NO/c11-9(12)8-6-10(7-8)4-2-1-3-5-10/h1-2,6H,3-5,7H2,(H2,11,12) |
| InChIKey | QVIAOQRABJXQTQ-UHFFFAOYSA-N |
| Density | 1.131g/cm3 (Cal.) |
|---|---|
| Boiling point | 365.908°C at 760 mmHg (Cal.) |
| Flash point | 175.095°C (Cal.) |
| Refractive index | 1.574 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Spiro[3.5]Nona-1,6-Diene-2-Carboxamide |