Online Database of Chemicals from Around the World
| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
 | www.purerechem.com | |||
 | +86 (551) 6288-8437 +86 18096409024 | |||
 | info@purerechem.com | |||
 | QQ Chat | |||
 | Skype Chat | |||
 | WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | Lacosamide EP Impurity B |
|---|---|
| Synonyms | 2-Acetamido-3-(benzylamino)-3-oxopropyl acetate |
| Molecular Structure |  |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.30 |
| CAS Registry Number | 1822463-67-1 |
| SMILES | CC(OCC(NC(C)=O)C(NCC1=CC=CC=C1)=O)=O |
| Density | 1.2±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.525, Calc.* |
| Boiling Point | 572.8±50.0 °C (760 mmHg), Calc.* |
| Flash Point | 300.2±30.1 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for Lacosamide EP Impurity B |