| Guangzhou Lanning Biotechnology Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() | www.lanningbio.net | |||
![]() | +86 15813355568 | |||
![]() | lanningsale@sina.com | |||
![]() | QQ Chat | |||
![]() | WeChat: 15813355568 | |||
![]() | WhatsApp:+8615813355568 | |||
| Chemical manufacturer since 2022 | ||||
| chemBlink Standard supplier since 2023 | ||||
| Name | Cefadroxil R-Sulfoxide |
|---|---|
| Synonyms | (6R,7R)-7-[[(2R)-2-amino-2-(4-hydroxyphenyl)acetyl]amino]-3-methyl-5,8-dioxo-5?4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C16H17N3O6S |
| Molecular Weight | 379.39 |
| CAS Registry Number | 182290-77-3 |
| SMILES | CC1=C(N2[C@@H]([C@@H](C2=O)NC(=O)[C@@H](C3=CC=C(C=C3)O)N)S(=O)C1)C(=O)O |
| Density | 1.7±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.754, Calc.* |
| Boiling Point | 897.1±65.0 °C (760 mmHg), Calc.* |
| Flash Point | 496.3±34.3 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols | |
|---|---|
| Risk Statements | H302+H312+H332-H315-H319 Details |
| Safety Statements | P261-P271-P280-P302+P352-P305+P351+P338 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for Cefadroxil R-Sulfoxide |