Online Database of Chemicals from Around the World
|
CAS#: 18237-57-5 Product: 3-Phenyl-3,4-Dihydro-1,4-Benzoxazepin-5(2H)-One No suppilers available for the product. |
| Name | 3-Phenyl-3,4-Dihydro-1,4-Benzoxazepin-5(2H)-One |
|---|---|
| Synonyms | 1,4-Benzoxazepin-5(2H)-one, 3,4-dihydro-3-phenyl-; 3-Phenyl-2,3-dihydro-1,4-benzoxazepin-5-ol; 3-Phenyl-2,3-dihydro-1,4-benzoxazepin-5-ol # |
| Molecular Structure |  |
| Molecular Formula | C15H13NO2 |
| Molecular Weight | 239.27 |
| CAS Registry Number | 18237-57-5 |
| SMILES | O=C1c3c(OCC(N1)c2ccccc2)cccc3 |
| InChI | 1S/C15H13NO2/c17-15-12-8-4-5-9-14(12)18-10-13(16-15)11-6-2-1-3-7-11/h1-9,13H,10H2,(H,16,17) |
| InChIKey | FNXRXHIGVBYNLC-UHFFFAOYSA-N |
| Density | 1.186g/cm3 (Cal.) |
|---|---|
| Boiling point | 489.846°C at 760 mmHg (Cal.) |
| Flash point | 250.05°C (Cal.) |
| Refractive index | 1.589 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Phenyl-3,4-Dihydro-1,4-Benzoxazepin-5(2H)-One |