|
CAS#: 18259-37-5 Product: Ethylaminopropiophenone Hydrochloride No suppilers available for the product. |
| Name | Ethylaminopropiophenone Hydrochloride |
|---|---|
| Synonyms | Ethylamine; 1-Phenylpropan-1-One; 1-Propanone, 2-(Ethylamino)-1-Phenyl-; N-Ethylaminopropiophenone |
| Molecular Structure | ![]() |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 |
| CAS Registry Number | 18259-37-5 |
| SMILES | C1=C(C(=O)CC)C=CC=C1.C(N)C |
| InChI | 1S/C9H10O.C2H7N/c1-2-9(10)8-6-4-3-5-7-8;1-2-3/h3-7H,2H2,1H3;2-3H2,1H3 |
| InChIKey | XZTOYYNGSIGRLY-UHFFFAOYSA-N |
| Boiling point | 218°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 87.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethylaminopropiophenone Hydrochloride |