Online Database of Chemicals from Around the World
|
CAS#: 1829-41-0 Product: Methoxytriphenylsilane No suppilers available for the product. |
| Name | Methoxytriphenylsilane |
|---|---|
| Synonyms | Methoxy(Triphenyl)Silane; Silane, Methoxytriphenyl- |
| Molecular Structure |  |
| Molecular Formula | C19H18OSi |
| Molecular Weight | 290.44 |
| CAS Registry Number | 1829-41-0 |
| EINECS | 217-382-1 |
| SMILES | C1=CC=CC=C1[Si](C2=CC=CC=C2)(C3=CC=CC=C3)OC |
| InChI | 1S/C19H18OSi/c1-20-21(17-11-5-2-6-12-17,18-13-7-3-8-14-18)19-15-9-4-10-16-19/h2-16H,1H3 |
| InChIKey | BKXVGDZNDSIUAI-UHFFFAOYSA-N |
| Density | 1.082g/cm3 (Cal.) |
|---|---|
| Boiling point | 327.853°C at 760 mmHg (Cal.) |
| Flash point | 152.644°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methoxytriphenylsilane |