Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | (3aR,6aS)-3,3-Difluorohexahydro-2H-Cyclopenta[b]Furan-2-One |
|---|---|
| Synonyms | (3aR,6aS)-3,3-difluorohexahydro-2H-cyclopenta[b]furan-2-one |
| Molecular Structure | ![CAS#: 182932-06-5， (3aR,6aS)-3,3-Difluorohexahydro-2H-Cyclopenta[b]Furan-2-One](/moreStructures/182932-06-5.gif) |
| Molecular Formula | C7H8F2O2 |
| Molecular Weight | 162.13 |
| CAS Registry Number | 182932-06-5 |
| SMILES | C1C[C@@H]2[C@H](C1)OC(=O)C2(F)F |
| InChI | 1S/C7H8F2O2/c8-7(9)4-2-1-3-5(4)11-6(7)10/h4-5H,1-3H2/t4-,5+/m1/s1 |
| InChIKey | UVAOPQJKFGPWFN-UHNVWZDZSA-N |
| Density | 1.323g/cm3 (Cal.) |
|---|---|
| Boiling point | 229.915°C at 760 mmHg (Cal.) |
| Flash point | 90.328°C (Cal.) |
| Refractive index | 1.442 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (3aR,6aS)-3,3-Difluorohexahydro-2H-Cyclopenta[b]Furan-2-One |