Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Tyger Scientific Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (609) 434-0144 | |||
|
sales@tygersci.com | |||
| Chemical manufacturer since 1992 | ||||
| Name | Methyl (1,4-Dibenzyl-2-Piperazinyl)Acetate |
|---|---|
| Synonyms | (1,4-Dibenzyl-piperazin-2-yl)-aceticacidmethylester; 2-PIPERAZINEACETICACID, 1,4-BIS(PHENYLMETHYL)-, METHYL ESTER; Methyl2-(1,4-dibenzylpiperazin-2-yl)acetate |
| Molecular Structure |  |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.44 |
| CAS Registry Number | 183742-32-7 |
| SMILES | COC(=O)CC2CN(CCN2Cc1ccccc1)Cc3ccccc3 |
| InChI | 1S/C21H26N2O2/c1-25-21(24)14-20-17-22(15-18-8-4-2-5-9-18)12-13-23(20)16-19-10-6-3-7-11-19/h2-11,20H,12-17H2,1H3 |
| InChIKey | JCQKPXHKGNJTQQ-UHFFFAOYSA-N |
| Density | 1.118g/cm3 (Cal.) |
|---|---|
| Boiling point | 441.296°C at 760 mmHg (Cal.) |
| Flash point | 220.688°C (Cal.) |
| Refractive index | 1.572 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl (1,4-Dibenzyl-2-Piperazinyl)Acetate |