|
CAS#: 18383-58-9 Product: [(1R,3R)-2,2-Dimethyl-3-(2-Methyl-1-Propen-1-Yl)Cyclopropyl]Methanol No suppilers available for the product. |
| Name | [(1R,3R)-2,2-Dimethyl-3-(2-Methyl-1-Propen-1-Yl)Cyclopropyl]Methanol |
|---|---|
| Synonyms | trans-Chrysanthemyl alcohol; ZINC01656184 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H18O |
| Molecular Weight | 154.25 |
| CAS Registry Number | 18383-58-9 |
| SMILES | OC[C@@H]1[C@@H](\C=C(/C)C)C1(C)C |
| InChI | 1S/C10H18O/c1-7(2)5-8-9(6-11)10(8,3)4/h5,8-9,11H,6H2,1-4H3/t8-,9-/m1/s1 |
| InChIKey | HIPIENNKVJCMAP-RKDXNWHRSA-N |
| Density | 0.95g/cm3 (Cal.) |
|---|---|
| Boiling point | 264.389°C at 760 mmHg (Cal.) |
| Flash point | 85°C (Cal.) |
| Refractive index | 1.523 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [(1R,3R)-2,2-Dimethyl-3-(2-Methyl-1-Propen-1-Yl)Cyclopropyl]Methanol |