|
CAS#: 18395-97-6 Product: 1,6-Hexanediylbis[Dichloro(Methyl)Silane] No suppilers available for the product. |
| Name | 1,6-Hexanediylbis[Dichloro(Methyl)Silane] |
|---|---|
| Synonyms | 1,6-Bis(dichloromethylsilyl)hexane |
| Molecular Structure | ![]() |
| Molecular Formula | C8H18Cl4Si2 |
| Molecular Weight | 312.21 |
| CAS Registry Number | 18395-97-6 |
| SMILES | C[Si](Cl)(Cl)CCCCCC[Si](C)(Cl)Cl |
| InChI | 1S/C8H18Cl4Si2/c1-13(9,10)7-5-3-4-6-8-14(2,11)12/h3-8H2,1-2H3 |
| InChIKey | NDFFILGCGJJGOS-UHFFFAOYSA-N |
| Density | 1.125g/cm3 (Cal.) |
|---|---|
| Boiling point | 288.509°C at 760 mmHg (Cal.) |
| Flash point | 121.963°C (Cal.) |
| Refractive index | 1.459 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,6-Hexanediylbis[Dichloro(Methyl)Silane] |