| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() | www.bocsci.com | |||
![]() | +1 (631) 485-4226 | |||
![]() | +1 (631) 614-7828 | |||
![]() | info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink Standard supplier since 2010 | ||||
| Name | Isoleojaponin |
|---|---|
| Synonyms | (4S)-4-[2-(furan-3-yl)ethyl]-2-hydroxy-3,4,8,8-tetramethyl-6,7-dihydro-5H-naphthalen-1-one |
| Molecular Structure | ![]() |
| Molecular Formula | C20H26O3 |
| Molecular Weight | 314.42 |
| CAS Registry Number | 1840966-49-5 |
| SMILES | CC1=C(C(=O)C2=C([C@]1(C)CCC3=COC=C3)CCCC2(C)C)O |
| Density | 1.1±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.560, Calc.* |
| Boiling Point | 457.0±45.0 °C (760 mmHg), Calc.* |
| Flash Point | 230.2±28.7 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Isoleojaponin |