|
CAS#: 184106-70-5 Product: 2H-Pyrido[3,4-b][1,3]Thiazolo[4,5-E]Indole No suppilers available for the product. |
| Name | 2H-Pyrido[3,4-b][1,3]Thiazolo[4,5-E]Indole |
|---|---|
| Synonyms | 2H-Pyrido[3,4-b][1,3]thiazolo[4,5-e]indol; 2H-Pyrido[3,4-b][1,3]thiazolo[4,5-e]indole; 2H-Pyrido[3,4-b][1,3]thiazolo[4,5-e]indole |
| Molecular Structure | ![]() |
| Molecular Formula | C12H7N3S |
| Molecular Weight | 225.27 |
| CAS Registry Number | 184106-70-5 |
| SMILES | c1cc2c(=NCS2)c3=c4ccncc4=Nc31 |
| InChI | 1S/C12H7N3S/c1-2-10-12(14-6-16-10)11-7-3-4-13-5-9(7)15-8(1)11/h1-5H,6H2 |
| InChIKey | ZVOZPDMOCFHOFF-UHFFFAOYSA-N |
| Density | 1.6±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 438.0±55.0°C at 760 mmHg (Cal.) |
| Flash point | 218.7±31.5°C (Cal.) |
| Refractive index | 1.887 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2H-Pyrido[3,4-b][1,3]Thiazolo[4,5-E]Indole |