Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 6-Hydroxy-1,4-Dimethyl-2(1H)-Quinolinone |
|---|---|
| Synonyms | 6-hydroxy-1,4-dimethylquinolin-2(1H)-one |
| Molecular Structure |  |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 |
| CAS Registry Number | 1843-88-5 |
| SMILES | Oc1ccc2c(c1)C(\C)=C/C(=O)N2C |
| InChI | 1S/C11H11NO2/c1-7-5-11(14)12(2)10-4-3-8(13)6-9(7)10/h3-6,13H,1-2H3 |
| InChIKey | TUSXLRWSPGPMHW-UHFFFAOYSA-N |
| Density | 1.232g/cm3 (Cal.) |
|---|---|
| Boiling point | 352.583°C at 760 mmHg (Cal.) |
| Flash point | 167.037°C (Cal.) |
| Refractive index | 1.607 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Hydroxy-1,4-Dimethyl-2(1H)-Quinolinone |