| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() | www.bocsci.com | |||
![]() | +1 (631) 485-4226 | |||
![]() | +1 (631) 614-7828 | |||
![]() | info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink Standard supplier since 2010 | ||||
| Classification | Biochemical >> Nucleoside drugs >> Nucleotides and their analogues |
|---|---|
| Name | 8-Iodo-guanosine |
| Synonyms | 2-Amino-8-iodo-9-pentofuranosyl-1,9-dihydro-6h-purin-6-one |
| Molecular Structure | ![]() |
| Molecular Formula | C10H12IN5O5 |
| Molecular Weight | 409.14 |
| CAS Registry Number | 18438-99-8 |
| SMILES | C(C1C(C(C(O1)N2C3=C(C(=O)NC(=N3)N)N=C2I)O)O)O |
| Solubility | 3.045e+004 mg/L (25 °C water) |
|---|---|
| Density | 2.9±0.1 g/cm3, Calc.* |
| Index of Refraction | 2.041, Calc.* |
| Melting point | 276.86 °C |
| Boiling Point | 637.56 °C, 785.3±70.0 °C (760 mmHg), Calc.* |
| Flash Point | 428.7±35.7 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for 8-Iodo-guanosine |