Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (201) 478-8534 | |||
|
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 2,2'-Thiobis[4,6-Xylenol] |
|---|---|
| Synonyms | 2-(2-Hydroxy-3,5-Dimethyl-Phenyl)Sulfanyl-4,6-Dimethyl-Phenol; 2-[(2-Hydroxy-3,5-Dimethylphenyl)Thio]-4,6-Dimethylphenol; 2-[(2-Hydroxy-3,5-Dimethyl-Phenyl)Thio]-4,6-Dimethyl-Phenol |
| Molecular Structure | ![CAS#: 18508-61-7， 2,2'-Thiobis[4,6-Xylenol]](/moreStructures/18508-61-7.gif) |
| Molecular Formula | C16H18O2S |
| Molecular Weight | 274.38 |
| CAS Registry Number | 18508-61-7 |
| EINECS | 242-391-2 |
| SMILES | C2=C(SC1=C(O)C(=CC(=C1)C)C)C(=C(C=C2C)C)O |
| InChI | 1S/C16H18O2S/c1-9-5-11(3)15(17)13(7-9)19-14-8-10(2)6-12(4)16(14)18/h5-8,17-18H,1-4H3 |
| InChIKey | UNYRULLBEFEDBF-UHFFFAOYSA-N |
| Density | 1.235g/cm3 (Cal.) |
|---|---|
| Boiling point | 376.117°C at 760 mmHg (Cal.) |
| Flash point | 182.825°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2'-Thiobis[4,6-Xylenol] |