Online Database of Chemicals from Around the World
| Name | 2-(4-Chlorophenyl)-2-Hydroxyacetamide |
|---|---|
| Synonyms | 2-(4-Chlorophenyl)-2-Hydroxy-Acetamide; 2-(4-Chlorophenyl)-2-Hydroxy-Ethanamide; Brn 3129733 |
| Molecular Structure |  |
| Molecular Formula | C8H8ClNO2 |
| Molecular Weight | 185.61 |
| CAS Registry Number | 18584-27-5 |
| SMILES | C1=C(C(C(N)=O)O)C=CC(=C1)Cl |
| InChI | 1S/C8H8ClNO2/c9-6-3-1-5(2-4-6)7(11)8(10)12/h1-4,7,11H,(H2,10,12) |
| InChIKey | LDVLVMRFNCMVLS-UHFFFAOYSA-N |
| Density | 1.393g/cm3 (Cal.) |
|---|---|
| Boiling point | 383.936°C at 760 mmHg (Cal.) |
| Flash point | 185.998°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(4-Chlorophenyl)-2-Hydroxyacetamide |
