Online Database of Chemicals from Around the World
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
 |
+380 (44) 522-2458 | |||
 |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 2-(Methylamino)Benzophenone |
|---|---|
| Synonyms | (2-Methylaminophenyl)-Phenyl-Methanone; Zinc01514111; Methanone, (2-(Methylamino)Phenyl)Phenyl- |
| Molecular Structure |  |
| Molecular Formula | C14H13NO |
| Molecular Weight | 211.26 |
| CAS Registry Number | 1859-76-3 |
| SMILES | C2=C(C(=O)C1=C(C=CC=C1)NC)C=CC=C2 |
| InChI | 1S/C14H13NO/c1-15-13-10-6-5-9-12(13)14(16)11-7-3-2-4-8-11/h2-10,15H,1H3 |
| InChIKey | AGKPGIOZNCJFTQ-UHFFFAOYSA-N |
| Density | 1.13g/cm3 (Cal.) |
|---|---|
| Boiling point | 388.91°C at 760 mmHg (Cal.) |
| Flash point | 159.624°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Methylamino)Benzophenone |