| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 13417589054/ | |||
![]() |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | (4E)-4-(Hydroxyimino)-3-Methoxy-2,5-Cyclohexadien-1-One |
|---|---|
| Synonyms | (E)-4-(hydroxyimino)-3-methoxycyclohexa-2,5-dienone |
| Molecular Structure | ![]() |
| Molecular Formula | C7H7NO3 |
| Molecular Weight | 153.14 |
| CAS Registry Number | 186194-64-9 |
| SMILES | CO/C/1=C/C(=O)/C=C\C\1=N/O |
| InChI | 1S/C7H7NO3/c1-11-7-4-5(9)2-3-6(7)8-10/h2-4,10H,1H3/b8-6+ |
| InChIKey | RRHPJPXOBURYQX-SOFGYWHQSA-N |
| Density | 1.26g/cm3 (Cal.) |
|---|---|
| Boiling point | 320.441°C at 760 mmHg (Cal.) |
| Flash point | 147.598°C (Cal.) |
| Refractive index | 1.542 (Cal.) |
| (1) | N. Sardone, O. Carugo, J. Charalambous and D. V. Raghvani. 3-Methoxy-1,4-benzoquinone 4-Oxime, Acta Cryst. (1996). C52, 3202-3204 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (4E)-4-(Hydroxyimino)-3-Methoxy-2,5-Cyclohexadien-1-One |