Online Database of Chemicals from Around the World
|
CAS#: 18621-76-6 Product: But-2-Enylene Bisacrylate No suppilers available for the product. |
| Name | But-2-Enylene Bisacrylate |
|---|---|
| Synonyms | 4-Prop-2-Enoyloxybut-2-Enyl Prop-2-Enoate; Prop-2-Enoic Acid 4-(1-Oxoprop-2-Enoxy)But-2-Enyl Ester; Prop-2-Enoic Acid [(E)-4-(1-Oxoprop-2-Enoxy)But-2-Enyl] Ester |
| Molecular Structure |  |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.20 |
| CAS Registry Number | 18621-76-6 |
| EINECS | 242-448-1 |
| SMILES | C(OC(C=C)=O)\C=C\COC(C=C)=O |
| InChI | 1S/C10H12O4/c1-3-9(11)13-7-5-6-8-14-10(12)4-2/h3-6H,1-2,7-8H2/b6-5+ |
| InChIKey | ZJWKFUBDXPALAF-AATRIKPKSA-N |
| Density | 1.064g/cm3 (Cal.) |
|---|---|
| Boiling point | 277.758°C at 760 mmHg (Cal.) |
| Flash point | 133.416°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for But-2-Enylene Bisacrylate |