| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() | www.purerechem.com | |||
![]() | +86 (551) 6288-8437 +86 18096409024 | |||
![]() | info@purerechem.com | |||
![]() | QQ Chat | |||
![]() | Skype Chat | |||
![]() | WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | (R)-Licarbazepine Acetate |
|---|---|
| Synonyms | [(5R)-11-carbamoyl-5,6-dihydrobenzo[b][1]benzazepin-5-yl] acetate |
| Molecular Structure | ![]() |
| Molecular Formula | C17H16N2O3 |
| Molecular Weight | 296.32 |
| CAS Registry Number | 186694-45-1 |
| SMILES | CC(=O)O[C@@H]1CC2=CC=CC=C2N(C3=CC=CC=C13)C(=O)N |
| Solubility | 22.48 mg/L (25 °C water) |
|---|---|
| Density | 1.3±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.655, Calc.* |
| Melting point | 191.35 °C |
| Boiling Point | 454.52 °C, 427.4±55.0 °C (760 mmHg), Calc.* |
| Flash Point | 212.3±31.5 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (R)-Licarbazepine Acetate |