| Tocris Bioscience Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (636) 207-7651 | |||
![]() |
marketing@tocrisusa.com | |||
| Chemical manufacturer since 1982 | ||||
| Name | (1S)-1-{2-[4-(4-Carbamoylphenyl)-1-Piperazinyl]Ethyl}-N-Methyl-3,4-Dihydro-1H-Isochromene-6-Carboxamide |
|---|---|
| Synonyms | (1S)-1-[2 |
| Molecular Structure | ![]() |
| Molecular Formula | C24H30N4O3 |
| Molecular Weight | 422.52 |
| CAS Registry Number | 187665-65-2 |
| SMILES | CNC(=O)C1=CC2=C(C=C1)[C@@H](OCC2)CCN3CCN(CC3)C4=CC=C(C=C4)C(=O)N |
| InChI | 1S/C24H30N4O3/c1-26-24(30)19-4-7-21-18(16-19)9-15-31-22(21)8-10-27-11-13-28(14-12-27)20-5-2-17(3-6-20)23(25)29/h2-7,16,22H,8-15H2,1H3,(H2,25,29)(H,26,30)/t22-/m0/s1 |
| InChIKey | PNTVCCRNJOGKGA-QFIPXVFZSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 652.5±55.0°C at 760 mmHg (Cal.) |
| Flash point | 348.4±31.5°C (Cal.) |
| Refractive index | 1.596 (Cal.) |
| solubility | Soluble to 100 mM in DMSO and to 20 mM in ethanol |
| Market Analysis Reports |
| List of Reports Available for (1S)-1-{2-[4-(4-Carbamoylphenyl)-1-Piperazinyl]Ethyl}-N-Methyl-3,4-Dihydro-1H-Isochromene-6-Carboxamide |