Online Database of Chemicals from Around the World
| Name | 3-Isopropyl-2,3-Dimethylindoline |
|---|---|
| Synonyms | 3-Isopropyl-2,3-dimethylindoline # |
| Molecular Structure |  |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 |
| CAS Registry Number | 18781-62-9 |
| SMILES | c1cccc2c1C(C(N2)C)(C)C(C)C |
| InChI | 1S/C13H19N/c1-9(2)13(4)10(3)14-12-8-6-5-7-11(12)13/h5-10,14H,1-4H3 |
| InChIKey | QGBKERMPJRWFBZ-UHFFFAOYSA-N |
| Density | 0.923g/cm3 (Cal.) |
|---|---|
| Boiling point | 272.352°C at 760 mmHg (Cal.) |
| Flash point | 117.296°C (Cal.) |
| Refractive index | 1.5 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Isopropyl-2,3-Dimethylindoline |
