Online Database of Chemicals from Around the World
|
CAS#: 1879-26-1 Product: N-Methylurethanebenzenesulfohydrazine No suppilers available for the product. |
| Name | N-Methylurethanebenzenesulfohydrazine |
|---|---|
| Synonyms | N-Amino-4-(Carboxy-Methyl-Amino)Benzenesulfonimidic Acid; N-Methylurethanebenzenesulfohydrazine; P-Sulfocarbanilic Acid C-Methyl Ester, Hydrazide |
| Molecular Structure |  |
| Molecular Formula | C8H11N3O4S |
| Molecular Weight | 245.25 |
| CAS Registry Number | 1879-26-1 |
| SMILES | C1=C([S](=O)(O)=NN)C=CC(=C1)N(C(=O)O)C |
| InChI | 1S/C8H11N3O4S/c1-11(8(12)13)6-2-4-7(5-3-6)16(14,15)10-9/h2-5H,9H2,1H3,(H,12,13)(H,10,14,15) |
| InChIKey | ALBPLDNFOXLJCD-UHFFFAOYSA-N |
| Density | 1.54g/cm3 (Cal.) |
|---|---|
| Boiling point | 533.084°C at 760 mmHg (Cal.) |
| Flash point | 276.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Methylurethanebenzenesulfohydrazine |