|
CAS#: 1881-37-4 Product: 4-Fluoroestradiol No suppilers available for the product. |
| Name | 4-Fluoroestradiol |
|---|---|
| Synonyms | (17-Beta)-4-Fluoroestra-1,3,5(10)-Triene-3,17-Diol; 4-Fluoroestra-1,3,5-(10)-Triene-3,17-Beta-Diol; 4-Fluoroestradiol |
| Molecular Structure | ![]() |
| Molecular Formula | C18H23FO2 |
| Molecular Weight | 290.38 |
| CAS Registry Number | 1881-37-4 |
| SMILES | [C@@H]4(O)C3(C(C2C(C1=C(C(=C(O)C=C1)F)CC2)CC3)CC4)C |
| InChI | 1S/C18H23FO2/c1-18-9-8-11-10-4-6-15(20)17(19)13(10)3-2-12(11)14(18)5-7-16(18)21/h4,6,11-12,14,16,20-21H,2-3,5,7-9H2,1H3/t11?,12?,14?,16-,18?/m0/s1 |
| InChIKey | QZFXMXJXAUMHQR-AWMRIXHMSA-N |
| Density | 1.226g/cm3 (Cal.) |
|---|---|
| Boiling point | 427.067°C at 760 mmHg (Cal.) |
| Flash point | 212.083°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Fluoroestradiol |