Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 7,7A-Dihydro-1-Benzofuran-2,6-Dione |
|---|---|
| Synonyms | 7,7a-dihydrobenzofuran-2,6-dione |
| Molecular Structure |  |
| Molecular Formula | C8H6O3 |
| Molecular Weight | 150.13 |
| CAS Registry Number | 188107-53-1 |
| SMILES | O=C\1CC2OC(=O)/C=C2/C=C/1 |
| InChI | 1S/C8H6O3/c9-6-2-1-5-3-8(10)11-7(5)4-6/h1-3,7H,4H2 |
| InChIKey | QIZYUCVTAFYYEU-UHFFFAOYSA-N |
| Density | 1.35g/cm3 (Cal.) |
|---|---|
| Boiling point | 470.165°C at 760 mmHg (Cal.) |
| Flash point | 219.891°C (Cal.) |
| Refractive index | 1.571 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7,7A-Dihydro-1-Benzofuran-2,6-Dione |