Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Santa Cruz Biotechnology, Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (831) 457-3800 | |||
|
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Name | 1-[(3,4-Dimethoxyphenyl)Methyl]-7-Methoxy-Isoquinolin-6-Ol |
|---|---|
| Synonyms | 6-Demethyl Papaverine |
| Molecular Structure | ![CAS#: 18813-63-3， 1-[(3,4-Dimethoxyphenyl)Methyl]-7-Methoxy-Isoquinolin-6-Ol](/moreStructures/18813-63-3.gif) |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.36 |
| CAS Registry Number | 18813-63-3 |
| SMILES | COc1ccc(cc1OC)Cc3nccc2cc(O)c(cc23)OC |
| InChI | 1S/C19H19NO4/c1-22-17-5-4-12(9-19(17)24-3)8-15-14-11-18(23-2)16(21)10-13(14)6-7-20-15/h4-7,9-11,21H,8H2,1-3H3 |
| InChIKey | BFMUDRSIIFRJOG-UHFFFAOYSA-N |
| Density | 1.22g/cm3 (Cal.) |
|---|---|
| Boiling point | 502.68°C at 760 mmHg (Cal.) |
| Flash point | 257.812°C (Cal.) |
| Refractive index | 1.618 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[(3,4-Dimethoxyphenyl)Methyl]-7-Methoxy-Isoquinolin-6-Ol |