Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 4-Nitro-2,1-Benzoxazole |
|---|---|
| Synonyms | 2,1-Benzisoxazole, 4-nitro-; 2,1-Benzisoxazole,4-nitro-; 4-Nitro-2,1-benzoxazol |
| Molecular Structure |  |
| Molecular Formula | C7H4N2O3 |
| Molecular Weight | 164.12 |
| CAS Registry Number | 188860-13-1 |
| SMILES | c1cc2c(con2)c(c1)[N+](=O)[O-] |
| InChI | 1S/C7H4N2O3/c10-9(11)7-3-1-2-6-5(7)4-12-8-6/h1-4H |
| InChIKey | QWYNIHBIOHDNKR-UHFFFAOYSA-N |
| Density | 1.5±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 328.7±15.0°C at 760 mmHg (Cal.) |
| Flash point | 152.6±20.4°C (Cal.) |
| Refractive index | 1.658 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Nitro-2,1-Benzoxazole |