Online Database of Chemicals from Around the World
|
CAS#: 18916-46-6 Product: 2-Methoxy-Quinoxaline 4-Oxide No suppilers available for the product. |
| Name | 2-Methoxy-Quinoxaline 4-Oxide |
|---|---|
| Synonyms | 3-Methoxy-1-Oxido-Quinoxalin-1-Ium; 2-Methoxyquinoxaline 4-Oxide; Nsc521691 |
| Molecular Structure |  |
| Molecular Formula | C9H8N2O2 |
| Molecular Weight | 176.17 |
| CAS Registry Number | 18916-46-6 |
| SMILES | C1=CC2=C(C=C1)N=C(OC)C=[N+]2[O-] |
| InChI | 1S/C9H8N2O2/c1-13-9-6-11(12)8-5-3-2-4-7(8)10-9/h2-6H,1H3 |
| InChIKey | MODWRNFLLLIINR-UHFFFAOYSA-N |
| Density | 1.269g/cm3 (Cal.) |
|---|---|
| Boiling point | 327.736°C at 760 mmHg (Cal.) |
| Flash point | 152.01°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methoxy-Quinoxaline 4-Oxide |